C33H30Cl2O6 — CID 138971415
dipropan-2-yl 6-acetyl-5-(4-chlorophenyl)-4-[2-(4-chlorophenyl)ethynyl]-7-hydroxy-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 138971415) has the molecular formula C33H30Cl2O6 and a molecular weight of 593.50 g/mol. Its IUPAC name is dipropan-2-yl 6-acetyl-5-(4-chlorophenyl)-4-[2-(4-chlorophenyl)ethynyl]-7-hydroxy-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dipropan-2-yl 6-acetyl-5-(4-chlorophenyl)-4-[2-(4-chlorophenyl)ethynyl]-7-hydroxy-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 138971415 |
| Molecular Formula | C33H30Cl2O6 |
| Molecular Weight | 593.50 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | dipropan-2-yl 6-acetyl-5-(4-chlorophenyl)-4-[2-(4-chlorophenyl)ethynyl]-7-hydroxy-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | CC(=O)c1c(O)c2c(c(C#Cc3ccc(Cl)cc3)c1-c1ccc(Cl)cc1)CC(C(=O)OC(C)C)(C(=O)OC(C)C)C2 |
| InChI | InChI=1S/C33H30Cl2O6/c1-18(2)40-31(38)33(32(39)41-19(3)4)16-26-25(15-8-21-6-11-23(34)12-7-21)29(22-9-13-24(35)14-10-22)28(20(5)36)30(37)27(26)17-33/h6-7,9-14,18-19,37H,16-17H2,1-5H3 |
| InChIKey | IPKDXTNYIZBBPQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|