C36H28F2O8 — CID 118605354
[4-[2-[2,5-difluoro-3,6-bis(2-methylprop-2-enoyloxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118605354) has the molecular formula C36H28F2O8 and a molecular weight of 626.61 g/mol. Its IUPAC name is [4-[2-[2,5-difluoro-3,6-bis(2-methylprop-2-enoyloxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2,5-difluoro-3,6-bis(2-methylprop-2-enoyloxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605354 |
| Molecular Formula | C36H28F2O8 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | [4-[2-[2,5-difluoro-3,6-bis(2-methylprop-2-enoyloxy)-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C#Cc2c(F)c(OC(=O)C(=C)C)c(-c3ccc(OC(=O)C(=C)C)cc3)c(F)c2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C36H28F2O8/c1-19(2)33(39)43-25-14-9-23(10-15-25)11-18-27-29(37)32(46-36(42)22(7)8)28(30(38)31(27)45-35(41)21(5)6)24-12-16-26(17-13-24)44-34(40)20(3)4/h9-10,12-17H,1,3,5,7H2,2,4,6,8H3 |
| InChIKey | FLFJSBXMIFWAMN-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|