C43H39FO10 — CID 118605447
2-[4-[2-[5-fluoro-2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 118605447) has the molecular formula C43H39FO10 and a molecular weight of 734.77 g/mol. Its IUPAC name is 2-[4-[2-[5-fluoro-2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-[5-fluoro-2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605447 |
| Molecular Formula | C43H39FO10 |
| Molecular Weight | 734.77 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | 2-[4-[2-[5-fluoro-2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]ethynyl]phenyl]ethynyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C#Cc2c(F)c(OC(=O)C(=C)C)c(C#Cc3ccc(OCCOC(=O)C(=C)C)cc3)c(C)c2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C43H39FO10/c1-26(2)40(45)51-24-22-49-33-16-10-31(11-17-33)14-20-35-30(9)38(53-42(47)28(5)6)36(37(44)39(35)54-43(48)29(7)8)21-15-32-12-18-34(19-13-32)50-23-25-52-41(46)27(3)4/h10-13,16-19H,1,3,5,7,22-25H2,2,4,6,8-9H3 |
| InChIKey | MVFHMQIVNYAPEN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.77 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|