C38H30O9 — CID 118605445
[4-[2-[2,6-dimethyl-3,5-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenoxy]methyl 2-methylprop-2-enoate (PubChem CID 118605445) has the molecular formula C38H30O9 and a molecular weight of 630.65 g/mol. Its IUPAC name is [4-[2-[2,6-dimethyl-3,5-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenoxy]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2,6-dimethyl-3,5-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605445 |
| Molecular Formula | C38H30O9 |
| Molecular Weight | 630.65 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | [4-[2-[2,6-dimethyl-3,5-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2c(OC(=O)C=C)c(C)c(C#Cc3ccc(OCOC(=O)C(=C)C)cc3)c(C)c2OC(=O)C=C)cc1 |
| InChI | InChI=1S/C38H30O9/c1-8-33(39)45-30-19-13-28(14-20-30)16-22-32-36(46-34(40)9-2)25(6)31(26(7)37(32)47-35(41)10-3)21-15-27-11-17-29(18-12-27)43-23-44-38(42)24(4)5/h8-14,17-20H,1-4,23H2,5-7H3 |
| InChIKey | BNKNQIZDKNCKQJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|