C45H36O8 — CID 118605555
[3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]-4-propylphenyl] 2-methylprop-2-enoate (PubChem CID 118605555) has the molecular formula C45H36O8 and a molecular weight of 704.78 g/mol. Its IUPAC name is [3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]-4-propylphenyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]-4-propylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605555 |
| Molecular Formula | C45H36O8 |
| Molecular Weight | 704.78 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | [3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]-4-propylphenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2ccc(-c3cc(OC(=O)C(=C)C)c(C#Cc4ccc(OC(=O)C=C)cc4)c(OC(=O)C(=C)C)c3CCC)cc2)cc1 |
| InChI | InChI=1S/C45H36O8/c1-8-11-37-39(34-21-14-31(15-22-34)12-13-32-16-23-35(24-17-32)50-41(46)9-2)28-40(52-44(48)29(4)5)38(43(37)53-45(49)30(6)7)27-20-33-18-25-36(26-19-33)51-42(47)10-3/h9-10,14-19,21-26,28H,2-4,6,8,11H2,1,5,7H3 |
| InChIKey | ZIUBDOOPVQQCLC-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.78 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|