C43H35FO8 — CID 118605725
[4-(3-fluoropropyl)-3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118605725) has the molecular formula C43H35FO8 and a molecular weight of 698.74 g/mol. Its IUPAC name is [4-(3-fluoropropyl)-3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(3-fluoropropyl)-3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605725 |
| Molecular Formula | C43H35FO8 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 698.23 |
| IUPAC Name | [4-(3-fluoropropyl)-3-(2-methylprop-2-enoyloxy)-2-[2-(4-prop-2-enoyloxyphenyl)ethynyl]-5-[4-(4-prop-2-enoyloxyphenyl)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2c(OC(=O)C(=C)C)cc(-c3ccc(-c4ccc(OC(=O)C=C)cc4)cc3)c(CCCF)c2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C43H35FO8/c1-7-39(45)49-33-20-11-29(12-21-33)13-24-36-38(51-42(47)27(3)4)26-37(35(10-9-25-44)41(36)52-43(48)28(5)6)32-16-14-30(15-17-32)31-18-22-34(23-19-31)50-40(46)8-2/h7-8,11-12,14-23,26H,1-3,5,9-10,25H2,4,6H3 |
| InChIKey | PONYVNZHBHCNGW-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|