C33H23FO8 — CID 118605344
[4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-(4-prop-2-enoyloxyphenyl)phenyl]ethynyl]phenyl] prop-2-enoate (PubChem CID 118605344) has the molecular formula C33H23FO8 and a molecular weight of 566.54 g/mol. Its IUPAC name is [4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-(4-prop-2-enoyloxyphenyl)phenyl]ethynyl]phenyl] prop-2-enoate.
| Compound Name | [4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-(4-prop-2-enoyloxyphenyl)phenyl]ethynyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 118605344 |
| Molecular Formula | C33H23FO8 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | [4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-(4-prop-2-enoyloxyphenyl)phenyl]ethynyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2c(F)c(OC(=O)C=C)c(-c3ccc(OC(=O)C=C)cc3)c(C)c2OC(=O)C=C)cc1 |
| InChI | InChI=1S/C33H23FO8/c1-6-26(35)39-23-15-10-21(11-16-23)12-19-25-31(34)33(42-29(38)9-4)30(20(5)32(25)41-28(37)8-3)22-13-17-24(18-14-22)40-27(36)7-2/h6-11,13-18H,1-4H2,5H3 |
| InChIKey | HPNVJZZBGUXJBG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|