C37H27FO8 — CID 123268443
2-[4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-[4-(2-prop-2-enoyloxyethenyl)phenyl]phenyl]ethynyl]phenyl]ethenyl prop-2-enoate (PubChem CID 123268443) has the molecular formula C37H27FO8 and a molecular weight of 618.61 g/mol. Its IUPAC name is 2-[4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-[4-(2-prop-2-enoyloxyethenyl)phenyl]phenyl]ethynyl]phenyl]ethenyl prop-2-enoate.
| Compound Name | 2-[4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-[4-(2-prop-2-enoyloxyethenyl)phenyl]phenyl]ethynyl]phenyl]ethenyl prop-2-enoate |
|---|---|
| PubChem CID | 123268443 |
| Molecular Formula | C37H27FO8 |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 2-[4-[2-[2-fluoro-5-methyl-3,6-di(prop-2-enoyloxy)-4-[4-(2-prop-2-enoyloxyethenyl)phenyl]phenyl]ethynyl]phenyl]ethenyl prop-2-enoate |
| SMILES | C=CC(=O)OC=Cc1ccc(C#Cc2c(F)c(OC(=O)C=C)c(-c3ccc(C=COC(=O)C=C)cc3)c(C)c2OC(=O)C=C)cc1 |
| InChI | InChI=1S/C37H27FO8/c1-6-30(39)43-22-20-26-12-10-25(11-13-26)16-19-29-35(38)37(46-33(42)9-4)34(24(5)36(29)45-32(41)8-3)28-17-14-27(15-18-28)21-23-44-31(40)7-2/h6-15,17-18,20-23H,1-4H2,5H3 |
| InChIKey | IOAVNBRXPWQPHF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|