About 2-phenylethenyl prop-2-enoate;silyloxysilane
2-phenylethenyl prop-2-enoate;silyloxysilane (PubChem CID 173165185) has the molecular formula C11H16O3Si2
and a molecular weight of 252.42 g/mol. Its IUPAC name is 2-phenylethenyl prop-2-enoate;silyloxysilane.
Molecular Properties
| Compound Name | 2-phenylethenyl prop-2-enoate;silyloxysilane |
| PubChem CID | 173165185 |
| Molecular Formula | C11H16O3Si2 |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-phenylethenyl prop-2-enoate;silyloxysilane |
| SMILES | C=CC(=O)OC=Cc1ccccc1.[SiH3]O[SiH3] |
| InChI | InChI=1S/C11H10O2.H6OSi2/c1-2-11(12)13-9-8-10-6-4-3-5-7-10;2-1-3/h2-9H,1H2;2-3H3 |
| InChIKey | QFNPFIOZDHIRPE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenyl prop-2-enoate;silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenyl prop-2-enoate;silyloxysilane?
The IUPAC name of 2-phenylethenyl prop-2-enoate;silyloxysilane (CID 173165185) is 2-phenylethenyl prop-2-enoate;silyloxysilane.
What is the SMILES notation for 2-phenylethenyl prop-2-enoate;silyloxysilane?
The canonical SMILES for 2-phenylethenyl prop-2-enoate;silyloxysilane is C=CC(=O)OC=Cc1ccccc1.[SiH3]O[SiH3].
What is the InChIKey of 2-phenylethenyl prop-2-enoate;silyloxysilane?
The InChIKey is QFNPFIOZDHIRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2.H6OSi2/c1-2-11(12)13-9-8-10-6-4-3-5-7-10;2-1-3/h2-9H,1H2;2-3H3.
What are the key properties of 2-phenylethenyl prop-2-enoate;silyloxysilane?
2-phenylethenyl prop-2-enoate;silyloxysilane has a molecular weight of 252.42 g/mol, XLogP of -0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenyl prop-2-enoate;silyloxysilane is sourced from PubChem (CID 173165185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).