About 2-phenylethenyl 3-hydroxypropanoate
2-phenylethenyl 3-hydroxypropanoate (PubChem CID 174401435) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-phenylethenyl 3-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-phenylethenyl 3-hydroxypropanoate |
| PubChem CID | 174401435 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-phenylethenyl 3-hydroxypropanoate |
| SMILES | O=C(CCO)OC=Cc1ccccc1 |
| InChI | InChI=1S/C11H12O3/c12-8-6-11(13)14-9-7-10-4-2-1-3-5-10/h1-5,7,9,12H,6,8H2 |
| InChIKey | DPLUDWLRDRHNBQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenyl 3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenyl 3-hydroxypropanoate?
The IUPAC name of 2-phenylethenyl 3-hydroxypropanoate (CID 174401435) is 2-phenylethenyl 3-hydroxypropanoate.
What is the SMILES notation for 2-phenylethenyl 3-hydroxypropanoate?
The canonical SMILES for 2-phenylethenyl 3-hydroxypropanoate is O=C(CCO)OC=Cc1ccccc1.
What is the InChIKey of 2-phenylethenyl 3-hydroxypropanoate?
The InChIKey is DPLUDWLRDRHNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c12-8-6-11(13)14-9-7-10-4-2-1-3-5-10/h1-5,7,9,12H,6,8H2.
What are the key properties of 2-phenylethenyl 3-hydroxypropanoate?
2-phenylethenyl 3-hydroxypropanoate has a molecular weight of 192.21 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenyl 3-hydroxypropanoate is sourced from PubChem (CID 174401435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).