About 2-O-amino 1-O-(2-phenylethenyl) oxalate
2-O-amino 1-O-(2-phenylethenyl) oxalate (PubChem CID 174927397) has the molecular formula C10H9NO4
and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-O-amino 1-O-(2-phenylethenyl) oxalate.
Molecular Properties
| Compound Name | 2-O-amino 1-O-(2-phenylethenyl) oxalate |
| PubChem CID | 174927397 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-O-amino 1-O-(2-phenylethenyl) oxalate |
| SMILES | NOC(=O)C(=O)OC=Cc1ccccc1 |
| InChI | InChI=1S/C10H9NO4/c11-15-10(13)9(12)14-7-6-8-4-2-1-3-5-8/h1-7H,11H2 |
| InChIKey | LTRNUIWPRDKYBE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-O-amino 1-O-(2-phenylethenyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-amino 1-O-(2-phenylethenyl) oxalate?
The IUPAC name of 2-O-amino 1-O-(2-phenylethenyl) oxalate (CID 174927397) is 2-O-amino 1-O-(2-phenylethenyl) oxalate.
What is the SMILES notation for 2-O-amino 1-O-(2-phenylethenyl) oxalate?
The canonical SMILES for 2-O-amino 1-O-(2-phenylethenyl) oxalate is NOC(=O)C(=O)OC=Cc1ccccc1.
What is the InChIKey of 2-O-amino 1-O-(2-phenylethenyl) oxalate?
The InChIKey is LTRNUIWPRDKYBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c11-15-10(13)9(12)14-7-6-8-4-2-1-3-5-8/h1-7H,11H2.
What are the key properties of 2-O-amino 1-O-(2-phenylethenyl) oxalate?
2-O-amino 1-O-(2-phenylethenyl) oxalate has a molecular weight of 207.19 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-amino 1-O-(2-phenylethenyl) oxalate is sourced from PubChem (CID 174927397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).