C42H30F2O6 — CID 123777068
[4-[2-[2,3-difluoro-4-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethenyl]phenyl]ethynyl]phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 123777068) has the molecular formula C42H30F2O6 and a molecular weight of 668.69 g/mol. Its IUPAC name is [4-[2-[2,3-difluoro-4-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethenyl]phenyl]ethynyl]phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2,3-difluoro-4-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethenyl]phenyl]ethynyl]phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123777068 |
| Molecular Formula | C42H30F2O6 |
| Molecular Weight | 668.69 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | [4-[2-[2,3-difluoro-4-[4-[2-[4-[2-(2-methylprop-2-enoyloxy)ethenyl]phenyl]ethynyl]phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(C#Cc2ccc(COC(=O)C(=C)C)cc2)c(F)c(F)c1-c1ccc(C#Cc2ccc(C=COC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C42H30F2O6/c1-6-37(45)50-36-25-35(22-19-30-13-15-33(16-14-30)26-49-42(47)28(4)5)39(43)40(44)38(36)34-20-17-31(18-21-34)8-7-29-9-11-32(12-10-29)23-24-48-41(46)27(2)3/h6,9-18,20-21,23-25H,1-2,4,26H2,3,5H3 |
| InChIKey | NWYLPZJESPRASQ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|