C40H36F2O8 — CID 118605415
[4,5-bis(2-fluoroethyl)-2-prop-2-enoyloxy-6-[4-(prop-2-enoyloxymethyl)phenyl]-3-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 118605415) has the molecular formula C40H36F2O8 and a molecular weight of 682.72 g/mol. Its IUPAC name is [4,5-bis(2-fluoroethyl)-2-prop-2-enoyloxy-6-[4-(prop-2-enoyloxymethyl)phenyl]-3-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4,5-bis(2-fluoroethyl)-2-prop-2-enoyloxy-6-[4-(prop-2-enoyloxymethyl)phenyl]-3-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605415 |
| Molecular Formula | C40H36F2O8 |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | [4,5-bis(2-fluoroethyl)-2-prop-2-enoyloxy-6-[4-(prop-2-enoyloxymethyl)phenyl]-3-[2-[4-(prop-2-enoyloxymethyl)phenyl]ethynyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(C#Cc2c(CCF)c(CCF)c(-c3ccc(COC(=O)C=C)cc3)c(COC(=O)C(=C)C)c2OC(=O)C=C)cc1 |
| InChI | InChI=1S/C40H36F2O8/c1-6-35(43)47-23-28-11-9-27(10-12-28)15-18-33-31(19-21-41)32(20-22-42)38(30-16-13-29(14-17-30)24-48-36(44)7-2)34(25-49-40(46)26(4)5)39(33)50-37(45)8-3/h6-14,16-17H,1-4,19-25H2,5H3 |
| InChIKey | LWXRPCCEINANOP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|