C39H31FO11 — CID 118605418
[4-[2-[2-(2-fluoroethyl)-3-prop-2-enoyloxy-5-(prop-2-enoyloxymethoxy)-4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]methyl prop-2-enoate (PubChem CID 118605418) has the molecular formula C39H31FO11 and a molecular weight of 694.66 g/mol. Its IUPAC name is [4-[2-[2-(2-fluoroethyl)-3-prop-2-enoyloxy-5-(prop-2-enoyloxymethoxy)-4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]methyl prop-2-enoate.
| Compound Name | [4-[2-[2-(2-fluoroethyl)-3-prop-2-enoyloxy-5-(prop-2-enoyloxymethoxy)-4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 118605418 |
| Molecular Formula | C39H31FO11 |
| Molecular Weight | 694.66 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | [4-[2-[2-(2-fluoroethyl)-3-prop-2-enoyloxy-5-(prop-2-enoyloxymethoxy)-4-[2-[4-(prop-2-enoyloxymethoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(C#Cc2cc(OCOC(=O)C=C)c(C#Cc3ccc(OCOC(=O)C=C)cc3)c(OC(=O)C=C)c2CCF)cc1 |
| InChI | InChI=1S/C39H31FO11/c1-5-35(41)48-24-45-30-16-10-27(11-17-30)9-15-29-23-34(47-26-50-37(43)7-3)33(39(32(29)21-22-40)51-38(44)8-4)20-14-28-12-18-31(19-13-28)46-25-49-36(42)6-2/h5-8,10-13,16-19,23H,1-4,21-22,24-26H2 |
| InChIKey | GWURCSCLQARAKB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|