C42H38O9 — CID 118605846
[(E)-2-[4-[2-[3-methyl-2,5-bis(2-methylprop-2-enoyloxy)-4-[[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenoxy]methyl]phenyl]ethynyl]phenyl]ethenyl] 2-methylprop-2-enoate (PubChem CID 118605846) has the molecular formula C42H38O9 and a molecular weight of 686.76 g/mol. Its IUPAC name is [(E)-2-[4-[2-[3-methyl-2,5-bis(2-methylprop-2-enoyloxy)-4-[[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenoxy]methyl]phenyl]ethynyl]phenyl]ethenyl] 2-methylprop-2-enoate.
| Compound Name | [(E)-2-[4-[2-[3-methyl-2,5-bis(2-methylprop-2-enoyloxy)-4-[[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenoxy]methyl]phenyl]ethynyl]phenyl]ethenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605846 |
| Molecular Formula | C42H38O9 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | [(E)-2-[4-[2-[3-methyl-2,5-bis(2-methylprop-2-enoyloxy)-4-[[(E)-2-[4-(2-methylprop-2-enoyloxy)phenyl]ethenoxy]methyl]phenyl]ethynyl]phenyl]ethenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O/C=C/c1ccc(C#Cc2cc(OC(=O)C(=C)C)c(CO/C=C/c3ccc(OC(=O)C(=C)C)cc3)c(C)c2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C42H38O9/c1-26(2)39(43)48-23-21-32-12-10-31(11-13-32)14-17-34-24-37(50-41(45)28(5)6)36(30(9)38(34)51-42(46)29(7)8)25-47-22-20-33-15-18-35(19-16-33)49-40(44)27(3)4/h10-13,15-16,18-24H,1,3,5,7,25H2,2,4,6,8-9H3/b22-20+,23-21+ |
| InChIKey | TUFHBOCEBYIISP-DQPVQCHKSA-N |
| XLogP | 8.12 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|