C38H30O10 — CID 123454697
2-[3-methyl-2,6-bis(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl 4-prop-2-enoyloxybenzoate (PubChem CID 123454697) has the molecular formula C38H30O10 and a molecular weight of 646.65 g/mol. Its IUPAC name is 2-[3-methyl-2,6-bis(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl 4-prop-2-enoyloxybenzoate.
| Compound Name | 2-[3-methyl-2,6-bis(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl 4-prop-2-enoyloxybenzoate |
|---|---|
| PubChem CID | 123454697 |
| Molecular Formula | C38H30O10 |
| Molecular Weight | 646.65 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | 2-[3-methyl-2,6-bis(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl 4-prop-2-enoyloxybenzoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2cc(OC(=O)C(=C)C)c(C=COC(=O)c3ccc(OC(=O)C=C)cc3)c(OC(=O)C(=C)C)c2C)cc1 |
| InChI | InChI=1S/C38H30O10/c1-8-33(39)45-29-16-11-26(12-17-29)10-13-28-22-32(47-36(41)23(3)4)31(35(25(28)7)48-37(42)24(5)6)20-21-44-38(43)27-14-18-30(19-15-27)46-34(40)9-2/h8-9,11-12,14-22H,1-3,5H2,4,6-7H3 |
| InChIKey | WITSVQKFDNKGRZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|