C39H30O8 — CID 123751698
2-[4-prop-2-enoyloxy-2-[4-(2-prop-2-enoyloxyethenyl)phenyl]-5-[2-[4-(2-prop-2-enoyloxyethenyl)phenyl]ethynyl]phenyl]ethenyl 2-methylprop-2-enoate (PubChem CID 123751698) has the molecular formula C39H30O8 and a molecular weight of 626.66 g/mol. Its IUPAC name is 2-[4-prop-2-enoyloxy-2-[4-(2-prop-2-enoyloxyethenyl)phenyl]-5-[2-[4-(2-prop-2-enoyloxyethenyl)phenyl]ethynyl]phenyl]ethenyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-prop-2-enoyloxy-2-[4-(2-prop-2-enoyloxyethenyl)phenyl]-5-[2-[4-(2-prop-2-enoyloxyethenyl)phenyl]ethynyl]phenyl]ethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123751698 |
| Molecular Formula | C39H30O8 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 2-[4-prop-2-enoyloxy-2-[4-(2-prop-2-enoyloxyethenyl)phenyl]-5-[2-[4-(2-prop-2-enoyloxyethenyl)phenyl]ethynyl]phenyl]ethenyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC=Cc1ccc(C#Cc2cc(C=COC(=O)C(=C)C)c(-c3ccc(C=COC(=O)C=C)cc3)cc2OC(=O)C=C)cc1 |
| InChI | InChI=1S/C39H30O8/c1-6-36(40)44-22-19-29-11-9-28(10-12-29)15-18-33-25-32(21-24-46-39(43)27(4)5)34(26-35(33)47-38(42)8-3)31-16-13-30(14-17-31)20-23-45-37(41)7-2/h6-14,16-17,19-26H,1-4H2,5H3 |
| InChIKey | FSDUMXMVHSFLQN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|