C20H14O2 — CID 150592906
[4-(4-phenylbuta-1,3-diynyl)phenyl] 2-methylprop-2-enoate (PubChem CID 150592906) has the molecular formula C20H14O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is [4-(4-phenylbuta-1,3-diynyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(4-phenylbuta-1,3-diynyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150592906 |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [4-(4-phenylbuta-1,3-diynyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H14O2/c1-16(2)20(21)22-19-14-12-18(13-15-19)11-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,12-15H,1H2,2H3 |
| InChIKey | IQFYGPACZOVOBI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|