C42H35F3O10 — CID 123920803
1-[2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(trifluoromethyl)phenyl]prop-1-en-2-yl 4-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 123920803) has the molecular formula C42H35F3O10 and a molecular weight of 756.73 g/mol. Its IUPAC name is 1-[2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(trifluoromethyl)phenyl]prop-1-en-2-yl 4-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | 1-[2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(trifluoromethyl)phenyl]prop-1-en-2-yl 4-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 123920803 |
| Molecular Formula | C42H35F3O10 |
| Molecular Weight | 756.73 g/mol |
| Exact Mass | 756.22 |
| IUPAC Name | 1-[2-methyl-3,6-bis(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-5-(trifluoromethyl)phenyl]prop-1-en-2-yl 4-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C#Cc2c(OC(=O)C(=C)C)c(C)c(C=C(C)OC(=O)c3ccc(OC(=O)C(=C)C)cc3)c(OC(=O)C(=C)C)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C42H35F3O10/c1-22(2)37(46)52-30-16-11-28(12-17-30)13-20-32-34(42(43,44)45)36(55-40(49)25(7)8)33(27(10)35(32)54-39(48)24(5)6)21-26(9)51-41(50)29-14-18-31(19-15-29)53-38(47)23(3)4/h11-12,14-19,21H,1,3,5,7H2,2,4,6,8-10H3 |
| InChIKey | QYLVIXSHWODPDX-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|