C41H33F3O9 — CID 123268252
[4-[2-[2-methyl-3,5-bis(2-methylprop-2-enoyloxy)-4-[3-[3-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]-6-(trifluoromethyl)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate (PubChem CID 123268252) has the molecular formula C41H33F3O9 and a molecular weight of 726.70 g/mol. Its IUPAC name is [4-[2-[2-methyl-3,5-bis(2-methylprop-2-enoyloxy)-4-[3-[3-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]-6-(trifluoromethyl)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[2-methyl-3,5-bis(2-methylprop-2-enoyloxy)-4-[3-[3-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]-6-(trifluoromethyl)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123268252 |
| Molecular Formula | C41H33F3O9 |
| Molecular Weight | 726.70 g/mol |
| Exact Mass | 726.21 |
| IUPAC Name | [4-[2-[2-methyl-3,5-bis(2-methylprop-2-enoyloxy)-4-[3-[3-(2-methylprop-2-enoyloxy)phenyl]-3-oxoprop-1-enyl]-6-(trifluoromethyl)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C#Cc2c(C)c(OC(=O)C(=C)C)c(C=CC(=O)c3cccc(OC(=O)C(=C)C)c3)c(OC(=O)C(=C)C)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C41H33F3O9/c1-22(2)37(46)50-29-16-13-27(14-17-29)15-18-31-26(9)35(52-39(48)24(5)6)32(36(34(31)41(42,43)44)53-40(49)25(7)8)19-20-33(45)28-11-10-12-30(21-28)51-38(47)23(3)4/h10-14,16-17,19-21H,1,3,5,7H2,2,4,6,8-9H3 |
| InChIKey | CTBYZEUMHADTRS-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.70 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|