C23H22O4 — CID 101356228
dimethyl hexacyclo[9.6.1.11,11.02,10.04,8.012,17]nonadeca-3,8,12,14,16-pentaene-6,6-dicarboxylate (PubChem CID 101356228) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is dimethyl hexacyclo[9.6.1.11,11.02,10.04,8.012,17]nonadeca-3,8,12,14,16-pentaene-6,6-dicarboxylate.
| Compound Name | dimethyl hexacyclo[9.6.1.11,11.02,10.04,8.012,17]nonadeca-3,8,12,14,16-pentaene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 101356228 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | dimethyl hexacyclo[9.6.1.11,11.02,10.04,8.012,17]nonadeca-3,8,12,14,16-pentaene-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CC3C(C=C2C1)C12CC3(C1)c1ccccc12 |
| InChI | InChI=1S/C23H22O4/c1-26-19(24)21(20(25)27-2)9-13-7-17-18(8-14(13)10-21)23-11-22(17,12-23)15-5-3-4-6-16(15)23/h3-8,17-18H,9-12H2,1-2H3 |
| InChIKey | BBGCGNCEMUFODF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|