C14H18N4O2 — CID 66191017
methyl 1-(2-azidoethylamino)-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 66191017) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 1-(2-azidoethylamino)-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl 1-(2-azidoethylamino)-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 66191017 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 1-(2-azidoethylamino)-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C1(NCCN=[N+]=[N-])CCCc2ccccc21 |
| InChI | InChI=1S/C14H18N4O2/c1-20-13(19)14(16-9-10-17-18-15)8-4-6-11-5-2-3-7-12(11)14/h2-3,5,7,16H,4,6,8-10H2,1H3 |
| InChIKey | PSMBPOAIHXLDKI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|