About methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate
methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate (PubChem CID 66191414) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate |
| PubChem CID | 66191414 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NCCN=[N+]=[N-])CCC(C)(C)CC1 |
| InChI | InChI=1S/C12H22N4O2/c1-11(2)4-6-12(7-5-11,10(17)18-3)14-8-9-15-16-13/h14H,4-9H2,1-3H3 |
| InChIKey | ZFTPPJLJEKXRBC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate?
The IUPAC name of methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate (CID 66191414) is methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate is COC(=O)C1(NCCN=[N+]=[N-])CCC(C)(C)CC1.
What is the InChIKey of methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate?
The InChIKey is ZFTPPJLJEKXRBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2/c1-11(2)4-6-12(7-5-11,10(17)18-3)14-8-9-15-16-13/h14H,4-9H2,1-3H3.
What are the key properties of methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate?
methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate has a molecular weight of 254.33 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-azidoethylamino)-4,4-dimethylcyclohexane-1-carboxylate is sourced from PubChem (CID 66191414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).