C15H28N4O2 — CID 115999252
ethyl 1-(2-azidoethylamino)-3,3,5,5-tetramethylcyclohexane-1-carboxylate (PubChem CID 115999252) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is ethyl 1-(2-azidoethylamino)-3,3,5,5-tetramethylcyclohexane-1-carboxylate.
| Compound Name | ethyl 1-(2-azidoethylamino)-3,3,5,5-tetramethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115999252 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | ethyl 1-(2-azidoethylamino)-3,3,5,5-tetramethylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NCCN=[N+]=[N-])CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H28N4O2/c1-6-21-12(20)15(17-7-8-18-19-16)10-13(2,3)9-14(4,5)11-15/h17H,6-11H2,1-5H3 |
| InChIKey | MCZDWPNWTVORCF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|