C10H18N4O4S — CID 66191623
ethyl 3-(2-azidoethylamino)-1,1-dioxothiane-3-carboxylate (PubChem CID 66191623) has the molecular formula C10H18N4O4S and a molecular weight of 290.35 g/mol. Its IUPAC name is ethyl 3-(2-azidoethylamino)-1,1-dioxothiane-3-carboxylate.
| Compound Name | ethyl 3-(2-azidoethylamino)-1,1-dioxothiane-3-carboxylate |
|---|---|
| PubChem CID | 66191623 |
| Molecular Formula | C10H18N4O4S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | ethyl 3-(2-azidoethylamino)-1,1-dioxothiane-3-carboxylate |
| SMILES | CCOC(=O)C1(NCCN=[N+]=[N-])CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N4O4S/c1-2-18-9(15)10(12-5-6-13-14-11)4-3-7-19(16,17)8-10/h12H,2-8H2,1H3 |
| InChIKey | YEQBVRZPJQLMSK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|