About methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate
methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate (PubChem CID 66190501) has the molecular formula C9H16N4O4S
and a molecular weight of 276.32 g/mol. Its IUPAC name is methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate |
| PubChem CID | 66190501 |
| Molecular Formula | C9H16N4O4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate |
| SMILES | COC(=O)C1(NCCCN=[N+]=[N-])CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N4O4S/c1-17-8(14)9(3-6-18(15,16)7-9)11-4-2-5-12-13-10/h11H,2-7H2,1H3 |
| InChIKey | PJNLMFGFYIUQCC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate?
The IUPAC name of methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate (CID 66190501) is methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate.
What is the SMILES notation for methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate?
The canonical SMILES for methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate is COC(=O)C1(NCCCN=[N+]=[N-])CCS(=O)(=O)C1.
What is the InChIKey of methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate?
The InChIKey is PJNLMFGFYIUQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O4S/c1-17-8(14)9(3-6-18(15,16)7-9)11-4-2-5-12-13-10/h11H,2-7H2,1H3.
What are the key properties of methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate?
methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate has a molecular weight of 276.32 g/mol, XLogP of 0.01, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-azidopropylamino)-1,1-dioxothiolane-3-carboxylate is sourced from PubChem (CID 66190501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).