C11H20N4O3 — CID 106873196
1-(3-azidopropylamino)-3-methoxycyclohexane-1-carboxylic acid (PubChem CID 106873196) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(3-azidopropylamino)-3-methoxycyclohexane-1-carboxylic acid.
| Compound Name | 1-(3-azidopropylamino)-3-methoxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106873196 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-(3-azidopropylamino)-3-methoxycyclohexane-1-carboxylic acid |
| SMILES | COC1CCCC(NCCCN=[N+]=[N-])(C(=O)O)C1 |
| InChI | InChI=1S/C11H20N4O3/c1-18-9-4-2-5-11(8-9,10(16)17)13-6-3-7-14-15-12/h9,13H,2-8H2,1H3,(H,16,17) |
| InChIKey | PCOODBQBSUGPGF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|