C10H19N5O2 — CID 106822803
1-(3-azidopropylamino)-3-ethoxycyclobutane-1-carboxamide (PubChem CID 106822803) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(3-azidopropylamino)-3-ethoxycyclobutane-1-carboxamide.
| Compound Name | 1-(3-azidopropylamino)-3-ethoxycyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 106822803 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-(3-azidopropylamino)-3-ethoxycyclobutane-1-carboxamide |
| SMILES | CCOC1CC(NCCCN=[N+]=[N-])(C(N)=O)C1 |
| InChI | InChI=1S/C10H19N5O2/c1-2-17-8-6-10(7-8,9(11)16)13-4-3-5-14-15-12/h8,13H,2-7H2,1H3,(H2,11,16) |
| InChIKey | TVEONMMNENJKIC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|