C13H16ClN5O — CID 115349341
2-(3-azidopropylamino)-5-chloro-1,3-dihydroindene-2-carboxamide (PubChem CID 115349341) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-5-chloro-1,3-dihydroindene-2-carboxamide.
| Compound Name | 2-(3-azidopropylamino)-5-chloro-1,3-dihydroindene-2-carboxamide |
|---|---|
| PubChem CID | 115349341 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-(3-azidopropylamino)-5-chloro-1,3-dihydroindene-2-carboxamide |
| SMILES | [N-]=[N+]=NCCCNC1(C(N)=O)Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C13H16ClN5O/c14-11-3-2-9-7-13(12(15)20,8-10(9)6-11)17-4-1-5-18-19-16/h2-3,6,17H,1,4-5,7-8H2,(H2,15,20) |
| InChIKey | BVWINSQPPTYPII-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|