C9H15N3O2 — CID 11435544
ethyl 1-(azidomethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 11435544) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is ethyl 1-(azidomethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | ethyl 1-(azidomethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11435544 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | ethyl 1-(azidomethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(CN=[N+]=[N-])CC1(C)C |
| InChI | InChI=1S/C9H15N3O2/c1-4-14-7(13)9(6-11-12-10)5-8(9,2)3/h4-6H2,1-3H3 |
| InChIKey | PGQJJPQJXCONQQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|