C8H13N3O3 — CID 11735779
cis-methyl (1S,2S)-2-azido-1-hydroxycyclohexane-1-carboxylate (PubChem CID 11735779) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-azido-1-hydroxycyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,2S)-2-azido-1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11735779 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | cis-methyl (1S,2S)-2-azido-1-hydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)CCCC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H13N3O3/c1-14-7(12)8(13)5-3-2-4-6(8)10-11-9/h6,13H,2-5H2,1H3/t6-,8-/m0/s1 |
| InChIKey | XYTTUFMOTNELFH-XPUUQOCRSA-N |
| XLogP | 1.14 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|