C11H19N7O2 — CID 149433762
tert-butyl N-(1,2-diazidocyclohexyl)carbamate (PubChem CID 149433762) has the molecular formula C11H19N7O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is tert-butyl N-(1,2-diazidocyclohexyl)carbamate.
| Compound Name | tert-butyl N-(1,2-diazidocyclohexyl)carbamate |
|---|---|
| PubChem CID | 149433762 |
| Molecular Formula | C11H19N7O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl N-(1,2-diazidocyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(N=[N+]=[N-])CCCCC1N=[N+]=[N-] |
| InChI | InChI=1S/C11H19N7O2/c1-10(2,3)20-9(19)14-11(16-18-13)7-5-4-6-8(11)15-17-12/h8H,4-7H2,1-3H3,(H,14,19) |
| InChIKey | AOUUSHZMLBAVNI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|