C7H8O4 — CID 152952236
6,8-dioxaspiro[3.5]nonane-5,9-dione (PubChem CID 152952236) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 6,8-dioxaspiro[3.5]nonane-5,9-dione.
| Compound Name | 6,8-dioxaspiro[3.5]nonane-5,9-dione |
|---|---|
| PubChem CID | 152952236 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 6,8-dioxaspiro[3.5]nonane-5,9-dione |
| SMILES | O=C1OCOC(=O)C12CCC2 |
| InChI | InChI=1S/C7H8O4/c8-5-7(2-1-3-7)6(9)11-4-10-5/h1-4H2 |
| InChIKey | UOXUZQILUGSYEM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|