C14H16BO8- — CID 145196186
7,9,17,18-tetraoxa-8-boranuidatrispiro[4.2.2.411.28.25]nonadecane-6,10,16,19-tetrone (PubChem CID 145196186) has the molecular formula C14H16BO8- and a molecular weight of 323.09 g/mol. Its IUPAC name is 7,9,17,18-tetraoxa-8-boranuidatrispiro[4.2.2.411.28.25]nonadecane-6,10,16,19-tetrone.
| Compound Name | 7,9,17,18-tetraoxa-8-boranuidatrispiro[4.2.2.411.28.25]nonadecane-6,10,16,19-tetrone |
|---|---|
| PubChem CID | 145196186 |
| Molecular Formula | C14H16BO8- |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 7,9,17,18-tetraoxa-8-boranuidatrispiro[4.2.2.411.28.25]nonadecane-6,10,16,19-tetrone |
| SMILES | O=C1O[B-]2(OC(=O)C13CCCC3)OC(=O)C1(CCCC1)C(=O)O2 |
| InChI | InChI=1S/C14H16BO8/c16-9-13(5-1-2-6-13)10(17)21-15(20-9)22-11(18)14(12(19)23-15)7-3-4-8-14/h1-8H2/q-1 |
| InChIKey | CPWHSYMHBRQMEB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|