C10H12O3 — CID 141056738
spiro[4.5]decane-6,8,10-trione (PubChem CID 141056738) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is spiro[4.5]decane-6,8,10-trione.
| Compound Name | spiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 141056738 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | spiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1CC(=O)C2(CCCC2)C(=O)C1 |
| InChI | InChI=1S/C10H12O3/c11-7-5-8(12)10(9(13)6-7)3-1-2-4-10/h1-6H2 |
| InChIKey | LIEHTSHDTVEJCZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|