C10H16N2O2 — CID 82469216
8,11-diazaspiro[5.6]dodecane-7,12-dione (PubChem CID 82469216) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 8,11-diazaspiro[5.6]dodecane-7,12-dione.
| Compound Name | 8,11-diazaspiro[5.6]dodecane-7,12-dione |
|---|---|
| PubChem CID | 82469216 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 8,11-diazaspiro[5.6]dodecane-7,12-dione |
| SMILES | O=C1NCCNC(=O)C12CCCCC2 |
| InChI | InChI=1S/C10H16N2O2/c13-8-10(4-2-1-3-5-10)9(14)12-7-6-11-8/h1-7H2,(H,11,13)(H,12,14) |
| InChIKey | NABDJUVDCMAVJE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|