C9H16N2O — CID 105433866
2,10-diazaspiro[4.6]undecan-1-one (PubChem CID 105433866) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,10-diazaspiro[4.6]undecan-1-one.
| Compound Name | 2,10-diazaspiro[4.6]undecan-1-one |
|---|---|
| PubChem CID | 105433866 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2,10-diazaspiro[4.6]undecan-1-one |
| SMILES | O=C1NCCC12CCCCNC2 |
| InChI | InChI=1S/C9H16N2O/c12-8-9(4-6-11-8)3-1-2-5-10-7-9/h10H,1-7H2,(H,11,12) |
| InChIKey | NIJSWDAMBIQKKO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |