C11H19NO — CID 148701523
8,8-dimethyl-2-azaspiro[4.5]decan-1-one (PubChem CID 148701523) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 8,8-dimethyl-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8,8-dimethyl-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 148701523 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 8,8-dimethyl-2-azaspiro[4.5]decan-1-one |
| SMILES | CC1(C)CCC2(CCNC2=O)CC1 |
| InChI | InChI=1S/C11H19NO/c1-10(2)3-5-11(6-4-10)7-8-12-9(11)13/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | NVLLKZWQGBFFPX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |