C11H17NO3 — CID 58230108
9,12-dioxa-3-azadispiro[4.2.48.25]tetradecan-4-one (PubChem CID 58230108) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 9,12-dioxa-3-azadispiro[4.2.48.25]tetradecan-4-one.
| Compound Name | 9,12-dioxa-3-azadispiro[4.2.48.25]tetradecan-4-one |
|---|---|
| PubChem CID | 58230108 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 9,12-dioxa-3-azadispiro[4.2.48.25]tetradecan-4-one |
| SMILES | O=C1NCCC12CCC1(CC2)OCCO1 |
| InChI | InChI=1S/C11H17NO3/c13-9-10(5-6-12-9)1-3-11(4-2-10)14-7-8-15-11/h1-8H2,(H,12,13) |
| InChIKey | VOTHTBBQNLDSGA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |