C12H13NO2 — CID 150627581
spiro[2H-1-benzofuran-3,3'-piperidine]-2'-one (PubChem CID 150627581) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is spiro[2H-1-benzofuran-3,3'-piperidine]-2'-one.
| Compound Name | spiro[2H-1-benzofuran-3,3'-piperidine]-2'-one |
|---|---|
| PubChem CID | 150627581 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | spiro[2H-1-benzofuran-3,3'-piperidine]-2'-one |
| SMILES | O=C1NCCCC12COc1ccccc12 |
| InChI | InChI=1S/C12H13NO2/c14-11-12(6-3-7-13-11)8-15-10-5-2-1-4-9(10)12/h1-2,4-5H,3,6-8H2,(H,13,14) |
| InChIKey | IXFGGPGPUGLQDX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |