C16H15NO3 — CID 175913862
3',3'-dimethyl-2',6'-dioxospiro[2H-1-benzofuran-3,5'-cyclohexane]-1'-carbonitrile (PubChem CID 175913862) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3',3'-dimethyl-2',6'-dioxospiro[2H-1-benzofuran-3,5'-cyclohexane]-1'-carbonitrile.
| Compound Name | 3',3'-dimethyl-2',6'-dioxospiro[2H-1-benzofuran-3,5'-cyclohexane]-1'-carbonitrile |
|---|---|
| PubChem CID | 175913862 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3',3'-dimethyl-2',6'-dioxospiro[2H-1-benzofuran-3,5'-cyclohexane]-1'-carbonitrile |
| SMILES | CC1(C)CC2(COc3ccccc32)C(=O)C(C#N)C1=O |
| InChI | InChI=1S/C16H15NO3/c1-15(2)8-16(14(19)10(7-17)13(15)18)9-20-12-6-4-3-5-11(12)16/h3-6,10H,8-9H2,1-2H3 |
| InChIKey | UCQADGINORRJMM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|