C12H18O4S — CID 158235546
3,3-dimethyl-2H-1-benzofuran;ethanesulfonic acid (PubChem CID 158235546) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3,3-dimethyl-2H-1-benzofuran;ethanesulfonic acid.
| Compound Name | 3,3-dimethyl-2H-1-benzofuran;ethanesulfonic acid |
|---|---|
| PubChem CID | 158235546 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3,3-dimethyl-2H-1-benzofuran;ethanesulfonic acid |
| SMILES | CC1(C)COc2ccccc21.CCS(=O)(=O)O |
| InChI | InChI=1S/C10H12O.C2H6O3S/c1-10(2)7-11-9-6-4-3-5-8(9)10;1-2-6(3,4)5/h3-6H,7H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | GEXKBCDYQARGEK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|