C17H20O4S — CID 151089706
4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 151089706) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]cyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]cyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 151089706 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methyl]cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | CC1(C)COc2ccc(CC3=CC=C(S(=O)(=O)O)CC3)cc21 |
| InChI | InChI=1S/C17H20O4S/c1-17(2)11-21-16-8-5-13(10-15(16)17)9-12-3-6-14(7-4-12)22(18,19)20/h3,5-6,8,10H,4,7,9,11H2,1-2H3,(H,18,19,20) |
| InChIKey | MLWCIROZBBDSKC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|