C18H26O2 — CID 107293346
1-(3,3-dimethyl-2H-1-benzofuran-5-yl)octan-1-one (PubChem CID 107293346) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2H-1-benzofuran-5-yl)octan-1-one.
| Compound Name | 1-(3,3-dimethyl-2H-1-benzofuran-5-yl)octan-1-one |
|---|---|
| PubChem CID | 107293346 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(3,3-dimethyl-2H-1-benzofuran-5-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)c1ccc2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C18H26O2/c1-4-5-6-7-8-9-16(19)14-10-11-17-15(12-14)18(2,3)13-20-17/h10-12H,4-9,13H2,1-3H3 |
| InChIKey | UJXNIYQTJBZNRJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|