C17H24OS — CID 22640688
1-(4,4-dimethyl-2,3-dihydrothiochromen-7-yl)hexan-1-one (PubChem CID 22640688) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is 1-(4,4-dimethyl-2,3-dihydrothiochromen-7-yl)hexan-1-one.
| Compound Name | 1-(4,4-dimethyl-2,3-dihydrothiochromen-7-yl)hexan-1-one |
|---|---|
| PubChem CID | 22640688 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(4,4-dimethyl-2,3-dihydrothiochromen-7-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1ccc2c(c1)SCCC2(C)C |
| InChI | InChI=1S/C17H24OS/c1-4-5-6-7-15(18)13-8-9-14-16(12-13)19-11-10-17(14,2)3/h8-9,12H,4-7,10-11H2,1-3H3 |
| InChIKey | HVAGPMGMRFXAOD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|