C19H26O2 — CID 107293291
cyclooctyl-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone (PubChem CID 107293291) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is cyclooctyl-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone.
| Compound Name | cyclooctyl-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone |
|---|---|
| PubChem CID | 107293291 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | cyclooctyl-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone |
| SMILES | CC1(C)COc2ccc(C(=O)C3CCCCCCC3)cc21 |
| InChI | InChI=1S/C19H26O2/c1-19(2)13-21-17-11-10-15(12-16(17)19)18(20)14-8-6-4-3-5-7-9-14/h10-12,14H,3-9,13H2,1-2H3 |
| InChIKey | MZBLSGIIURTKRJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |