C17H15BrO2 — CID 107293240
(3-bromophenyl)-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone (PubChem CID 107293240) has the molecular formula C17H15BrO2 and a molecular weight of 331.21 g/mol. Its IUPAC name is (3-bromophenyl)-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone.
| Compound Name | (3-bromophenyl)-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone |
|---|---|
| PubChem CID | 107293240 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | (3-bromophenyl)-(3,3-dimethyl-2H-1-benzofuran-5-yl)methanone |
| SMILES | CC1(C)COc2ccc(C(=O)c3cccc(Br)c3)cc21 |
| InChI | InChI=1S/C17H15BrO2/c1-17(2)10-20-15-7-6-12(9-14(15)17)16(19)11-4-3-5-13(18)8-11/h3-9H,10H2,1-2H3 |
| InChIKey | XMOHDRLMNMXEDB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |