C13H13NO2 — CID 121207629
spiro[3H-indene-2,3'-piperidine]-1,2'-dione (PubChem CID 121207629) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is spiro[3H-indene-2,3'-piperidine]-1,2'-dione.
| Compound Name | spiro[3H-indene-2,3'-piperidine]-1,2'-dione |
|---|---|
| PubChem CID | 121207629 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | spiro[3H-indene-2,3'-piperidine]-1,2'-dione |
| SMILES | O=C1NCCCC12Cc1ccccc1C2=O |
| InChI | InChI=1S/C13H13NO2/c15-11-10-5-2-1-4-9(10)8-13(11)6-3-7-14-12(13)16/h1-2,4-5H,3,6-8H2,(H,14,16) |
| InChIKey | ZQTCVBUECAUNAD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|