About spiro[3H-indene-2,3'-piperidine]-1,2'-dione
spiro[3H-indene-2,3'-piperidine]-1,2'-dione (PubChem CID 121207629) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is spiro[3H-indene-2,3'-piperidine]-1,2'-dione.
Molecular Properties
| Compound Name | spiro[3H-indene-2,3'-piperidine]-1,2'-dione |
| PubChem CID | 121207629 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | spiro[3H-indene-2,3'-piperidine]-1,2'-dione |
| SMILES | O=C1NCCCC12Cc1ccccc1C2=O |
| InChI | InChI=1S/C13H13NO2/c15-11-10-5-2-1-4-9(10)8-13(11)6-3-7-14-12(13)16/h1-2,4-5H,3,6-8H2,(H,14,16) |
| InChIKey | ZQTCVBUECAUNAD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze spiro[3H-indene-2,3'-piperidine]-1,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-indene-2,3'-piperidine]-1,2'-dione?
The IUPAC name of spiro[3H-indene-2,3'-piperidine]-1,2'-dione (CID 121207629) is spiro[3H-indene-2,3'-piperidine]-1,2'-dione.
What is the SMILES notation for spiro[3H-indene-2,3'-piperidine]-1,2'-dione?
The canonical SMILES for spiro[3H-indene-2,3'-piperidine]-1,2'-dione is O=C1NCCCC12Cc1ccccc1C2=O.
What is the InChIKey of spiro[3H-indene-2,3'-piperidine]-1,2'-dione?
The InChIKey is ZQTCVBUECAUNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2/c15-11-10-5-2-1-4-9(10)8-13(11)6-3-7-14-12(13)16/h1-2,4-5H,3,6-8H2,(H,14,16).
What are the key properties of spiro[3H-indene-2,3'-piperidine]-1,2'-dione?
spiro[3H-indene-2,3'-piperidine]-1,2'-dione has a molecular weight of 215.25 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-indene-2,3'-piperidine]-1,2'-dione is sourced from PubChem (CID 121207629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).