About spiro[3H-indene-2,4'-oxane]-1-one
spiro[3H-indene-2,4'-oxane]-1-one (PubChem CID 100741937) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is spiro[3H-indene-2,4'-oxane]-1-one.
Molecular Properties
| Compound Name | spiro[3H-indene-2,4'-oxane]-1-one |
| PubChem CID | 100741937 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | spiro[3H-indene-2,4'-oxane]-1-one |
| SMILES | O=C1c2ccccc2CC12CCOCC2 |
| InChI | InChI=1S/C13H14O2/c14-12-11-4-2-1-3-10(11)9-13(12)5-7-15-8-6-13/h1-4H,5-9H2 |
| InChIKey | GPXNSSLWABAIMP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-indene-2,4'-oxane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-indene-2,4'-oxane]-1-one?
The IUPAC name of spiro[3H-indene-2,4'-oxane]-1-one (CID 100741937) is spiro[3H-indene-2,4'-oxane]-1-one.
What is the SMILES notation for spiro[3H-indene-2,4'-oxane]-1-one?
The canonical SMILES for spiro[3H-indene-2,4'-oxane]-1-one is O=C1c2ccccc2CC12CCOCC2.
What is the InChIKey of spiro[3H-indene-2,4'-oxane]-1-one?
The InChIKey is GPXNSSLWABAIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c14-12-11-4-2-1-3-10(11)9-13(12)5-7-15-8-6-13/h1-4H,5-9H2.
What are the key properties of spiro[3H-indene-2,4'-oxane]-1-one?
spiro[3H-indene-2,4'-oxane]-1-one has a molecular weight of 202.25 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-indene-2,4'-oxane]-1-one is sourced from PubChem (CID 100741937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).