C20H21NO — CID 10613541
1'-benzylspiro[3H-indene-2,4'-piperidine]-1-one (PubChem CID 10613541) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 1'-benzylspiro[3H-indene-2,4'-piperidine]-1-one.
| Compound Name | 1'-benzylspiro[3H-indene-2,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 10613541 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1'-benzylspiro[3H-indene-2,4'-piperidine]-1-one |
| SMILES | O=C1c2ccccc2CC12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C20H21NO/c22-19-18-9-5-4-8-17(18)14-20(19)10-12-21(13-11-20)15-16-6-2-1-3-7-16/h1-9H,10-15H2 |
| InChIKey | ROMKXPDOTZZBSQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |